1-Amino-1,2,3,4-tetrahydro-1-naphthalenecarboxylic acid hydrochloride

• Catalog Number: ACMA00000954
• Category: Amines
• Molecular Weight: 227.69
• Molecular Formula: C₁₁H₁₃NO₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 1-Amino-1,2,3,4-tetrahydro-1-naphthalenecarboxylic acid hydrochloride?

The molecular formula is C11H14ClNO2.

What is the molecular weight of 1-Amino-1,2,3,4-tetrahydro-1-naphthalenecarboxylic acid hydrochloride?

The molecular weight is 227.69 g/mol.

What is the IUPAC name of 1-Amino-1,2,3,4-tetrahydro-1-naphthalenecarboxylic acid hydrochloride?

The IUPAC name is 1-amino-3,4-dihydro-2H-naphthalene-1-carboxylic acid;hydrochloride.

What is the InChI of 1-Amino-1,2,3,4-tetrahydro-1-naphthalenecarboxylic acid hydrochloride?

The InChI is InChI=1S/C11H13NO2.ClH/c12-11(10(13)14)7-3-5-8-4-1-2-6-9(8)11;/h1-2,4,6H,3,5,7,12H2,(H,13,14);1H.

What is the InChIKey of 1-Amino-1,2,3,4-tetrahydro-1-naphthalenecarboxylic acid hydrochloride?

The InChIKey is RCMFQTWGBQONDW-UHFFFAOYSA-N.

What is the canonical SMILES of 1-Amino-1,2,3,4-tetrahydro-1-naphthalenecarboxylic acid hydrochloride?

The canonical SMILES is C1CC2=CC=CC=C2C(C1)(C(=O)O)N.Cl.

What is the hydrogen bond donor count of 1-Amino-1,2,3,4-tetrahydro-1-naphthalenecarboxylic acid hydrochloride?

The hydrogen bond donor count is 3.

What is the hydrogen bond acceptor count of 1-Amino-1,2,3,4-tetrahydro-1-naphthalenecarboxylic acid hydrochloride?

The hydrogen bond acceptor count is 3.

How many rotatable bonds are there in 1-Amino-1,2,3,4-tetrahydro-1-naphthalenecarboxylic acid hydrochloride?

There is 1 rotatable bond.

Is 1-Amino-1,2,3,4-tetrahydro-1-naphthalenecarboxylic acid hydrochloride a canonicalized compound?

Yes, it is canonicalized.