What is the molecular formula of 1-Allyl-2-methylbenzene?
The molecular formula is C10H12.
What is the molecular weight of 1-Allyl-2-methylbenzene?
The molecular weight is 132.20 g/mol.
What is the IUPAC name of 1-Allyl-2-methylbenzene?
The IUPAC name is 1-methyl-2-prop-2-enylbenzene.
What is the InChI of 1-Allyl-2-methylbenzene?
The InChI is InChI=1S/C10H12/c1-3-6-10-8-5-4-7-9(10)2/h3-5,7-8H,1,6H2,2H3.
What is the InChIKey of 1-Allyl-2-methylbenzene?
The InChIKey is SVIHJJUMPAUQNO-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Allyl-2-methylbenzene?
The canonical SMILES is CC1=CC=CC=C1CC=C.
What is the CAS number of 1-Allyl-2-methylbenzene?
The CAS number is 1587-04-8.
What is the EC number of 1-Allyl-2-methylbenzene?
The EC number is 624-280-4.
What is the DSSTox Substance ID of 1-Allyl-2-methylbenzene?
The DSSTox Substance ID is DTXSID4074697.
Is 1-Allyl-2-methylbenzene considered to be a compound with a defined atom stereocenter count?
No, 1-Allyl-2-methylbenzene has a defined atom stereocenter count of 0.