What is the molecular formula of 1-Acetyl-2-thiohydantoin?
The molecular formula of 1-Acetyl-2-thiohydantoin is C5H6N2O2S.
What is the molecular weight of 1-Acetyl-2-thiohydantoin?
The molecular weight of 1-Acetyl-2-thiohydantoin is 158.18 g/mol.
What is the IUPAC name of 1-Acetyl-2-thiohydantoin?
The IUPAC name of 1-Acetyl-2-thiohydantoin is 1-acetyl-2-sulfanylideneimidazolidin-4-one.
What is the InChI of 1-Acetyl-2-thiohydantoin?
The InChI of 1-Acetyl-2-thiohydantoin is InChI=1S/C5H6N2O2S/c1-3(8)7-2-4(9)6-5(7)10/h2H2,1H3,(H,6,9,10).
What is the InChIKey of 1-Acetyl-2-thiohydantoin?
The InChIKey of 1-Acetyl-2-thiohydantoin is DDWXNUFFAFBJDG-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Acetyl-2-thiohydantoin?
The canonical SMILES of 1-Acetyl-2-thiohydantoin is CC(=O)N1CC(=O)NC1=S.
What is the CAS number of 1-Acetyl-2-thiohydantoin?
The CAS number of 1-Acetyl-2-thiohydantoin is 584-26-9.
What is the European Community (EC) number of 1-Acetyl-2-thiohydantoin?
The European Community (EC) number of 1-Acetyl-2-thiohydantoin is 209-535-6.
What is the UNII of 1-Acetyl-2-thiohydantoin?
The UNII of 1-Acetyl-2-thiohydantoin is WMG5WO16JD.
What is the PubChem Compound ID for 1-Acetyl-2-thiohydantoin?
The PubChem Compound ID for 1-Acetyl-2-thiohydantoin is 684551.