1-[[(6R,7R)-7-[[(2Z)-(2-Amino-4-thiazolyl)(methoxyimino)acetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]-5,6,7,8-tetrahydro-quinolinium inner salt
1-[[(6R,7R)-7-[[(2Z)-(2-Amino-4-thiazolyl)(methoxyimino)acetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]-5,6,7,8-tetrahydro-quinolinium inner salt
If you have any other questions or need other size, please get a quote.
Catalog Number
ACM84957302
Product Name
1-[[(6R,7R)-7-[[(2Z)-(2-Amino-4-thiazolyl)(methoxyimino)acetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]-5,6,7,8-tetrahydro-quinolinium inner salt
The molecular formula of cefquinome is C23H24N6O5S2.
What is the molecular weight of cefquinome?
The molecular weight of cefquinome is 528.6 g/mol.
What is the IUPAC name of cefquinome?
The IUPAC name of cefquinome is (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(5,6,7,8-tetrahydroquinolin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
What is the InChI of cefquinome?
The InChI of cefquinome is InChI=1S/C23H24N6O5S2/c1-34-27-16(14-11-36-23(24)25-14)19(30)26-17-20(31)29-18(22(32)33)13(10-35-21(17)29)9-28-8-4-6-12-5-2-3-7-15(12)28/h4,6,8,11,17,21H,2-3,5,7,9-10H2,1H3,(H3-,24,25,26,30,32,33)/b27-16-/t17-,21-/m1/s1.
What is the CAS number of cefquinome?
The CAS number of cefquinome is 84957-30-2.
What is the European Community (EC) number of cefquinome?
The European Community (EC) number of cefquinome is 690-053-1.
What is the ChEMBL ID of cefquinome?
The ChEMBL ID of cefquinome is CHEMBL1631107.
What is the NCI Thesaurus Code of cefquinome?
The NCI Thesaurus Code of cefquinome is C79564.
What is the XLogP3 value of cefquinome?
The XLogP3 value of cefquinome is 1.5.
How many hydrogen bond acceptors does cefquinome have?
Cefquinome has 10 hydrogen bond acceptors.
※ Please kindly note that our products are for research use only.