What is the molecular formula of 1,6-Heptadien-4-ol?
The molecular formula of 1,6-Heptadien-4-ol is C7H12O.
What is the molecular weight of 1,6-Heptadien-4-ol?
The molecular weight of 1,6-Heptadien-4-ol is 112.17 g/mol.
What is the IUPAC name of 1,6-Heptadien-4-ol?
The IUPAC name of 1,6-Heptadien-4-ol is hepta-1,6-dien-4-ol.
What is the InChI of 1,6-Heptadien-4-ol?
The InChI of 1,6-Heptadien-4-ol is InChI=1S/C7H12O/c1-3-5-7(8)6-4-2/h3-4,7-8H,1-2,5-6H2.
What is the InChIKey of 1,6-Heptadien-4-ol?
The InChIKey of 1,6-Heptadien-4-ol is UTGFOWQYZKTZTN-UHFFFAOYSA-N.
What is the canonical SMILES of 1,6-Heptadien-4-ol?
The canonical SMILES of 1,6-Heptadien-4-ol is C=CCC(CC=C)O.
What is the CAS number of 1,6-Heptadien-4-ol?
The CAS number of 1,6-Heptadien-4-ol is 2883-45-6.
What is the EC number of 1,6-Heptadien-4-ol?
The EC number of 1,6-Heptadien-4-ol is 220-742-0.
What is the UNII of 1,6-Heptadien-4-ol?
The UNII of 1,6-Heptadien-4-ol is VD28S33WW8.
Is 1,6-Heptadien-4-ol a canonicalized compound?
Yes, 1,6-Heptadien-4-ol is a canonicalized compound.