What is the molecular formula of 1,5-Dibromo-2,6-dimethyl-naphthalene?
The molecular formula is C12H10Br2.
What are the synonyms for 1,5-Dibromo-2,6-dimethyl-naphthalene?
The synonyms are 1,5-Dibromo-2,6-dimethylnaphthalene, Naphthalene, 1,5-dibromo-2,6-dimethyl-, SCHEMBL7530012, DTXSID80679475, MFCD11053604, AS-37679, CS-0153483, J3.593.517G, and A920441.
When was 1,5-Dibromo-2,6-dimethyl-naphthalene created?
It was created on April 5, 2011.
When was 1,5-Dibromo-2,6-dimethyl-naphthalene last modified?
It was last modified on August 26, 2023.
What is the IUPAC name of 1,5-Dibromo-2,6-dimethyl-naphthalene?
The IUPAC name is 1,5-dibromo-2,6-dimethylnaphthalene.
What is the InChI of 1,5-Dibromo-2,6-dimethyl-naphthalene?
The InChI is InChI=1S/C12H10Br2/c1-7-3-5-10-9(11(7)13)6-4-8(2)12(10)14/h3-6H,1-2H3.
What is the InChIKey of 1,5-Dibromo-2,6-dimethyl-naphthalene?
The InChIKey is CJCKXYUJTNKMQF-UHFFFAOYSA-N.
What is the canonical SMILES of 1,5-Dibromo-2,6-dimethyl-naphthalene?
The canonical SMILES is CC1=C(C2=C(C=C1)C(=C(C=C2)C)Br)Br.
What is the CAS number of 1,5-Dibromo-2,6-dimethyl-naphthalene?
The CAS number is 20027-95-6.
What is the molecular weight of 1,5-Dibromo-2,6-dimethyl-naphthalene?
The molecular weight is 314.01g/mol.
※ Please kindly note that our products are for research use only.