What is the PubChem CID of 1,5-Dibenzamidoanthraquinone?
The PubChem CID of 1,5-Dibenzamidoanthraquinone is 65738.
What is the molecular formula of 1,5-Dibenzamidoanthraquinone?
The molecular formula of 1,5-Dibenzamidoanthraquinone is C28H18N2O4.
What is the molecular weight of 1,5-Dibenzamidoanthraquinone?
The molecular weight of 1,5-Dibenzamidoanthraquinone is 446.5 g/mol.
What is the IUPAC name of 1,5-Dibenzamidoanthraquinone?
The IUPAC name of 1,5-Dibenzamidoanthraquinone is N-(5-benzamido-9,10-dioxoanthracen-1-yl)benzamide.
What is the InChI of 1,5-Dibenzamidoanthraquinone?
The InChI of 1,5-Dibenzamidoanthraquinone is InChI=1S/C28H18N2O4/c31-25-20-14-8-16-22(30-28(34)18-11-5-2-6-12-18)24(20)26(32)19-13-7-15-21(23(19)25)29-27(33)17-9-3-1-4-10-17/h1-16H,(H,29,33)(H,30,34).
What is the InChIKey of 1,5-Dibenzamidoanthraquinone?
The InChIKey of 1,5-Dibenzamidoanthraquinone is PZNXLZZWWBSQQK-UHFFFAOYSA-N.
What is the canonical SMILES of 1,5-Dibenzamidoanthraquinone?
The canonical SMILES of 1,5-Dibenzamidoanthraquinone is C1=CC=C(C=C1)C(=O)NC2=CC=CC3=C2C(=O)C4=C(C3=O)C(=CC=C4)NC(=O)C5=CC=CC=C5.
What is the CAS number of 1,5-Dibenzamidoanthraquinone?
The CAS number of 1,5-Dibenzamidoanthraquinone is 82-18-8.
What is the hydrogen bond donor count of 1,5-Dibenzamidoanthraquinone?
The hydrogen bond donor count of 1,5-Dibenzamidoanthraquinone is 2.
※ Please kindly note that our products are for research use only.