What is the molecular formula of 1,4-diphenylbutadiyne?
The molecular formula is C16H10.
What is the molecular weight of 1,4-diphenylbutadiyne?
The molecular weight is 202.25 g/mol.
What is the IUPAC name of 1,4-diphenylbutadiyne?
The IUPAC name is 4-phenylbuta-1,3-diynylbenzene.
What is the InChI of 1,4-diphenylbutadiyne?
The InChI is InChI=1S/C16H10/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-6,9-12H.
What is the InChIKey of 1,4-diphenylbutadiyne?
The InChIKey is HMQFJYLWNWIYKQ-UHFFFAOYSA-N.
What is the canonical SMILES of 1,4-diphenylbutadiyne?
The canonical SMILES is C1=CC=C(C=C1)C#CC#CC2=CC=CC=C2.
What is the CAS number of 1,4-diphenylbutadiyne?
The CAS number is 886-66-8.
What is the related CAS number of 1,4-diphenylbutadiyne?
The related CAS number is 25135-09-5.
What is the EC number of 1,4-diphenylbutadiyne?
The EC number is 212-953-1.
What is the UNII of 1,4-diphenylbutadiyne?
The UNII is 84WV7G15RN.