What is the molecular formula of 1,4-Dibromobenzene-d4?
The molecular formula of 1,4-Dibromobenzene-d4 is C6H4Br2.
What are the synonyms of 1,4-Dibromobenzene-d4?
The synonyms of 1,4-Dibromobenzene-d4 are 4165-56-4, 1,4-dibromo-2,3,5,6-tetradeuteriobenzene, p-dibromobenzene-d4, and dibromo(?H?)benzene.
What is the molecular weight of 1,4-Dibromobenzene-d4?
The molecular weight of 1,4-Dibromobenzene-d4 is 239.93 g/mol.
What is the IUPAC name of 1,4-Dibromobenzene-d4?
The IUPAC name of 1,4-Dibromobenzene-d4 is 1,4-dibromo-2,3,5,6-tetradeuteriobenzene.
What is the InChI of 1,4-Dibromobenzene-d4?
The InChI of 1,4-Dibromobenzene-d4 is InChI=1S/C6H4Br2/c7-5-1-2-6(8)4-3-5/h1-4H/i1D,2D,3D,4D.
What is the InChIKey of 1,4-Dibromobenzene-d4?
The InChIKey of 1,4-Dibromobenzene-d4 is SWJPEBQEEAHIGZ-RHQRLBAQSA-N.
What is the canonical SMILES of 1,4-Dibromobenzene-d4?
The canonical SMILES of 1,4-Dibromobenzene-d4 is C1=CC(=CC=C1Br)Br.
What is the CAS number of 1,4-Dibromobenzene-d4?
The CAS number of 1,4-Dibromobenzene-d4 is 4165-56-4.
What is the EC number of 1,4-Dibromobenzene-d4?
The EC number of 1,4-Dibromobenzene-d4 is 690-120-5.