What is the PubChem CID of 1,3-Dimethoxynaphthalene?
The PubChem CID of 1,3-Dimethoxynaphthalene is 870756.
What is the molecular formula of 1,3-Dimethoxynaphthalene?
The molecular formula of 1,3-Dimethoxynaphthalene is C12H12O2.
What is the molecular weight of 1,3-Dimethoxynaphthalene?
The molecular weight of 1,3-Dimethoxynaphthalene is 188.22 g/mol.
What is the IUPAC name of 1,3-Dimethoxynaphthalene?
The IUPAC name of 1,3-Dimethoxynaphthalene is 1,3-dimethoxynaphthalene.
What is the InChI of 1,3-Dimethoxynaphthalene?
The InChI of 1,3-Dimethoxynaphthalene is InChI=1S/C12H12O2/c1-13-10-7-9-5-3-4-6-11(9)12(8-10)14-2/h3-8H,1-2H3.
What is the InChIKey of 1,3-Dimethoxynaphthalene?
The InChIKey of 1,3-Dimethoxynaphthalene is XAVOEDQPSYWNHI-UHFFFAOYSA-N.
What is the canonical SMILES of 1,3-Dimethoxynaphthalene?
The canonical SMILES of 1,3-Dimethoxynaphthalene is COC1=CC2=CC=CC=C2C(=C1)OC.
What is the CAS number of 1,3-Dimethoxynaphthalene?
The CAS number of 1,3-Dimethoxynaphthalene is 10075-61-3.
Is 1,3-Dimethoxynaphthalene a canonicalized compound?
Yes, 1,3-Dimethoxynaphthalene is a canonicalized compound.