What is the molecular formula of 1,3-Dibromobutane?
The molecular formula of 1,3-Dibromobutane is C4H8Br2.
What is the molecular weight of 1,3-Dibromobutane?
The molecular weight of 1,3-Dibromobutane is 215.91 g/mol.
What is the IUPAC name of 1,3-Dibromobutane?
The IUPAC name of 1,3-Dibromobutane is 1,3-dibromobutane.
What is the InChI of 1,3-Dibromobutane?
The InChI of 1,3-Dibromobutane is InChI=1S/C4H8Br2/c1-4(6)2-3-5/h4H,2-3H2,1H3.
What is the InChIKey of 1,3-Dibromobutane?
The InChIKey of 1,3-Dibromobutane is XZNGUVQDFJHPLU-UHFFFAOYSA-N.
What is the canonical SMILES of 1,3-Dibromobutane?
The canonical SMILES of 1,3-Dibromobutane is CC(CCBr)Br.
What is the CAS number of 1,3-Dibromobutane?
The CAS number of 1,3-Dibromobutane is 107-80-2.
What is the XLogP3-AA value of 1,3-Dibromobutane?
The XLogP3-AA value of 1,3-Dibromobutane is 2.5.
What is the heavy atom count of 1,3-Dibromobutane?
The heavy atom count of 1,3-Dibromobutane is 6.
Is 1,3-Dibromobutane a canonicalized compound?
Yes, 1,3-Dibromobutane is a canonicalized compound according to PubChem.