What is the molecular formula of 1,3-Bisbenzyl-2-oxoimidazolidine-4,5-dicarboxylic acid?
The molecular formula is C19H18N2O5.
What is the molecular weight of 1,3-Bisbenzyl-2-oxoimidazolidine-4,5-dicarboxylic acid?
The molecular weight is 354.4 g/mol.
What is the IUPAC name of 1,3-Bisbenzyl-2-oxoimidazolidine-4,5-dicarboxylic acid?
The IUPAC name is 1,3-dibenzyl-2-oxoimidazolidine-4,5-dicarboxylic acid.
What is the InChI of 1,3-Bisbenzyl-2-oxoimidazolidine-4,5-dicarboxylic acid?
The InChI is InChI=1S/C19H18N2O5/c22-17(23)15-16(18(24)25)21(12-14-9-5-2-6-10-14)19(26)20(15)11-13-7-3-1-4-8-13/h1-10,15-16H,11-12H2,(H,22,23)(H,24,25).
What is the InChIKey of 1,3-Bisbenzyl-2-oxoimidazolidine-4,5-dicarboxylic acid?
The InChIKey is QSMUFXXTSUEZJA-UHFFFAOYSA-N.
What is the Canonical SMILES of 1,3-Bisbenzyl-2-oxoimidazolidine-4,5-dicarboxylic acid?
The Canonical SMILES is C1=CC=C(C=C1)CN2C(C(N(C2=O)CC3=CC=CC=C3)C(=O)O).
What is the CAS number of 1,3-Bisbenzyl-2-oxoimidazolidine-4,5-dicarboxylic acid?
The CAS number is 59564-78-2.
What is the European Community (EC) Number of 1,3-Bisbenzyl-2-oxoimidazolidine-4,5-dicarboxylic acid?
The European Community (EC) Number is 257-308-5.
What is the Hydrogen Bond Donor Count of 1,3-Bisbenzyl-2-oxoimidazolidine-4,5-dicarboxylic acid?
The Hydrogen Bond Donor Count is 2.
What is the Rotatable Bond Count of 1,3-Bisbenzyl-2-oxoimidazolidine-4,5-dicarboxylic acid?
The Rotatable Bond Count is 6.
※ Please kindly note that our products are for research use only.