The molecular formula of the compound is C7H11N3O2.
What are the synonyms of the compound?
The synonyms of the compound are 1,3,8-triazaspiro[4.5]decane-2,4-dione, 13625-39-3, 1,3,8-Triaza-spiro[4.5]decane-2,4-dione, MFCD06660736, and piperidine-4-spirohydantoin.
What is the molecular weight of the compound?
The molecular weight of the compound is 169.18 g/mol.
When was the compound created and last modified?
The compound was created on August 8, 2005, and last modified on November 25, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 1,3,8-triazaspiro[4.5]decane-2,4-dione.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C7H11N3O2/c11-5-7(10-6(12)9-5)1-3-8-4-2-7/h8H,1-4H2,(H2,9,10,11,12).
What is the InChIKey of the compound?
The InChIKey of the compound is HRSWSISJJJDBOQ-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1CNCCC12C(=O)NC(=O)N2.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.