What is the PubChem CID of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide?
The PubChem CID of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide is 68151.
What is the molecular formula of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide?
The molecular formula of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide is C2H4O6S2.
Are there any synonyms for 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide?
Yes, the synonyms for 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide include carbyl sulfate and HSJ374FH79.
What is the molecular weight of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide?
The molecular weight of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide is 188.18 g/mol.
What is the IUPAC name of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide?
The IUPAC name of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide is 1,3,2,4-dioxadithiane 2,2,4,4-tetraoxide.
What is the InChI of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide?
The InChI of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide is InChI=1S/C2H4O6S2/c3-9(4)2-1-7-10(5,6)8-9/h1-2H2.
What is the InChIKey of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide?
The InChIKey of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide is VSANMHWDSONVEE-UHFFFAOYSA-N.
What is the Canonical SMILES of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide?
The Canonical SMILES of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide is C1CS(=O)(=O)OS(=O)(=O)O1.
What is the CAS number of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide?
The CAS number of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide is 503-41-3.
What is the molecular weight of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide according to PubChem?
The molecular weight of 1,3,2,4-Dioxadithiane 2,2,4,4-tetraoxide is 188.18 g/mol according to PubChem.