1-((2-Methoxyphenyl)methyl)-3-(2-methylphenyl)urea

• Catalog Number: ACMA00002873
• Category: Ethers
• Molecular Weight: 270.33
• Molecular Formula: C₁₆H₁₆O₃
• Hazard Statements: H317
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the PubChem CID of the compound?

PubChem CID: 5260668

What is the molecular formula of the compound?

Molecular Formula: C16H18N2O2

What is the molecular weight of the compound?

Molecular Weight: 270.33 g/mol

What is the IUPAC Name of the compound?

IUPAC Name: 1-[(2-methoxyphenyl)methyl]-3-(2-methylphenyl)urea

What is the InChI of the compound?

InChI: InChI=1S/C16H18N2O2/c1-12-7-3-5-9-14(12)18-16(19)17-11-13-8-4-6-10-15(13)20-2/h3-10H,11H2,1-2H3,(H2,17,18,19)

What is the InChIKey of the compound?

InChIKey: JHFOQLKEHLZVDQ-UHFFFAOYSA-N

What is the Canonical SMILES of the compound?

Canonical SMILES: CC1=CC=CC=C1NC(=O)NCC2=CC=CC=C2OC

What is the XLogP3-AA value of the compound?

XLogP3-AA: 2.8

How many hydrogen bond donor count does the compound have?

Hydrogen Bond Donor Count: 2

How many hydrogen bond acceptor count does the compound have?

Hydrogen Bond Acceptor Count: 2