What is the molecular formula of 1,2-Ethanedisulfonic acid?
The molecular formula of 1,2-Ethanedisulfonic acid is C2H6O6S2.
What is the molecular weight of 1,2-Ethanedisulfonic acid?
The molecular weight of 1,2-Ethanedisulfonic acid is 190.20 g/mol.
What is the IUPAC name of 1,2-Ethanedisulfonic acid?
The IUPAC name of 1,2-Ethanedisulfonic acid is ethane-1,2-disulfonic acid.
What is the InChI of 1,2-Ethanedisulfonic acid?
The InChI of 1,2-Ethanedisulfonic acid is InChI=1S/C2H6O6S2/c3-9(4,5)1-2-10(6,7)8/h1-2H2,(H,3,4,5)(H,6,7,8).
What is the InChIKey of 1,2-Ethanedisulfonic acid?
The InChIKey of 1,2-Ethanedisulfonic acid is AFAXGSQYZLGZPG-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2-Ethanedisulfonic acid?
The canonical SMILES of 1,2-Ethanedisulfonic acid is C(CS(=O)(=O)O)S(=O)(=O)O.
What is the CAS number of 1,2-Ethanedisulfonic acid?
The CAS number of 1,2-Ethanedisulfonic acid is 110-04-3.
What is the European Community (EC) Number of 1,2-Ethanedisulfonic acid?
The European Community (EC) Number of 1,2-Ethanedisulfonic acid is 203-732-0.
What is the UNII of 1,2-Ethanedisulfonic acid?
The UNII of 1,2-Ethanedisulfonic acid is DL69Y31QQV.
Where can I find more information about 1,2-Ethanedisulfonic acid?
More information about 1,2-Ethanedisulfonic acid can be found on the Wikipedia page for Ethanedisulfonic acid and various databases like PubChem, ChemIDplus, and ChEMBL.
※ Please kindly note that our products are for research use only.