What is the molecular formula of 1,2-Dihexyloxybenzene?
The molecular formula of 1,2-Dihexyloxybenzene is C18H30O2.
What is the molecular weight of 1,2-Dihexyloxybenzene?
The molecular weight of 1,2-Dihexyloxybenzene is 278.4 g/mol.
What is the IUPAC name of 1,2-Dihexyloxybenzene?
The IUPAC name of 1,2-Dihexyloxybenzene is 1,2-dihexoxybenzene.
What is the InChI of 1,2-Dihexyloxybenzene?
The InChI of 1,2-Dihexyloxybenzene is InChI=1S/C18H30O2/c1-3-5-7-11-15-19-17-13-9-10-14-18(17)20-16-12-8-6-4-2/h9-10,13-14H,3-8,11-12,15-16H2,1-2H3.
What is the InChIKey of 1,2-Dihexyloxybenzene?
The InChIKey of 1,2-Dihexyloxybenzene is XNBVDORAKLGCKG-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2-Dihexyloxybenzene?
The canonical SMILES of 1,2-Dihexyloxybenzene is CCCCCCOC1=CC=CC=C1OCCCCCC.
What is the CAS number of 1,2-Dihexyloxybenzene?
The CAS number of 1,2-Dihexyloxybenzene is 94259-20-8.
What is the XLogP3 value of 1,2-Dihexyloxybenzene?
The XLogP3 value of 1,2-Dihexyloxybenzene is 6.4.
How many hydrogen bond acceptors does 1,2-Dihexyloxybenzene have?
1,2-Dihexyloxybenzene has 2 hydrogen bond acceptors.