What is the molecular formula of 1,2-Diaminonaphthalene?
The molecular formula of 1,2-Diaminonaphthalene is C10H10N2.
What is the molecular weight of 1,2-Diaminonaphthalene?
The molecular weight of 1,2-Diaminonaphthalene is 158.20 g/mol.
What is the IUPAC name of 1,2-Diaminonaphthalene?
The IUPAC name of 1,2-Diaminonaphthalene is naphthalene-1,2-diamine.
What is the InChI of 1,2-Diaminonaphthalene?
The InChI of 1,2-Diaminonaphthalene is InChI=1S/C10H10N2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H,11-12H2.
What is the InChIKey of 1,2-Diaminonaphthalene?
The InChIKey of 1,2-Diaminonaphthalene is NTNWKDHZTDQSST-UHFFFAOYSA-N.
What is the Canonical SMILES of 1,2-Diaminonaphthalene?
The Canonical SMILES of 1,2-Diaminonaphthalene is C1=CC=C2C(=C1)C=CC(=C2N)N.
What is the CAS number of 1,2-Diaminonaphthalene?
The CAS number of 1,2-Diaminonaphthalene is 938-25-0.
What is the XLogP3-AA value of 1,2-Diaminonaphthalene?
The XLogP3-AA value of 1,2-Diaminonaphthalene is 1.8.
What is the hydrogen bond donor count of 1,2-Diaminonaphthalene?
The hydrogen bond donor count of 1,2-Diaminonaphthalene is 2.
Is 1,2-Diaminonaphthalene a canonicalized compound?
Yes, 1,2-Diaminonaphthalene is a canonicalized compound.