What is the PubChem CID for 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?
The PubChem CID for 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is 49761084.
What is the molecular formula of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?
The molecular formula of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is C11H21BClNO2.
What is the molecular weight of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?
The molecular weight of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is 245.55 g/mol.
What is the IUPAC Name of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?
The IUPAC Name of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is "4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine;hydrochloride."
What is the InChI of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?
The InChI of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is "InChI=1S/C11H20BNO2.ClH/c1-10(2)11(3,4)15-12(14-10)9-5-7-13-8-6-9;/h5,13H,6-8H2,1-4H3;1H."
What is the InChIKey of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?
The InChIKey of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is "WNMYCAJTXUCHBQ-UHFFFAOYSA-N."
What is the Canonical SMILES of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?
The Canonical SMILES of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is "B1(OC(C(O1)(C)C)(C)C)C2=CCNCC2.Cl."
What is the CAS number of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?
The CAS number of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is 1121057-75-7.
What is the molecular weight of 1,2,3,6-Tetrahydro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine hydrochloride?
The molecular weight of 1,2,3,6-Tetrahydro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine hydrochloride is not provided in the reference.
What is the EC number of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?
The EC number of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is 878-854-6.