What is the PubChem CID for 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester?
The PubChem CID for 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester is 21105461.
What is the molecular formula of 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester?
The molecular formula of 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester is C11H20BNO2.
What is another name for 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester?
Another name for 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester is 375853-82-0.
What is the computed IUPAC name of 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester?
The computed IUPAC name of 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine.
What is the InChI of 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester?
The InChI of 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester is InChI=1S/C11H20BNO2/c1-10(2)11(3,4)15-12(14-10)9-5-7-13-8-6-9/h5,13H,6-8H2,1-4H3.
What is the InChIKey of 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester?
The InChIKey of 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester is AIPUNCFCQBDNDJ-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester?
The canonical SMILES of 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester is B1(OC(C(O1)(C)C)(C)C)C2=CCNCC2.
What is the CAS number of 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester?
The CAS number of 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester is 375853-82-0.
What is the molecular weight of 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester?
The molecular weight of 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester is 209.10 g/mol.
Is 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester a canonicalized compound?
Yes, 1,2,3,6-Tetrahydropyridine-4-boronic acid pinacol ester is a canonicalized compound according to PubChem.