What is the molecular formula of 1,2,3,4-Tetrahydroquinoxaline?
The molecular formula of 1,2,3,4-Tetrahydroquinoxaline is C8H10N2.
What is the molecular weight of 1,2,3,4-Tetrahydroquinoxaline?
The molecular weight of 1,2,3,4-Tetrahydroquinoxaline is 134.18 g/mol.
What is the IUPAC name of 1,2,3,4-Tetrahydroquinoxaline?
The IUPAC name of 1,2,3,4-Tetrahydroquinoxaline is 1,2,3,4-tetrahydroquinoxaline.
What is the InChI of 1,2,3,4-Tetrahydroquinoxaline?
The InChI of 1,2,3,4-Tetrahydroquinoxaline is InChI=1S/C8H10N2/c1-2-4-8-7(3-1)9-5-6-10-8/h1-4,9-10H,5-6H2.
What is the InChIKey of 1,2,3,4-Tetrahydroquinoxaline?
The InChIKey of 1,2,3,4-Tetrahydroquinoxaline is HORKYAIEVBUXGM-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2,3,4-Tetrahydroquinoxaline?
The canonical SMILES of 1,2,3,4-Tetrahydroquinoxaline is C1CNC2=CC=CC=C2N1.
What is the CAS number of 1,2,3,4-Tetrahydroquinoxaline?
The CAS number of 1,2,3,4-Tetrahydroquinoxaline is 3476-89-9.
What is the UNII of 1,2,3,4-Tetrahydroquinoxaline?
The UNII of 1,2,3,4-Tetrahydroquinoxaline is 6U54P549YE.
What is the XLogP3-AA value of 1,2,3,4-Tetrahydroquinoxaline?
The XLogP3-AA value of 1,2,3,4-Tetrahydroquinoxaline is 1.7.
Is 1,2,3,4-Tetrahydroquinoxaline a canonicalized compound?
Yes, 1,2,3,4-Tetrahydroquinoxaline is a canonicalized compound.