1,2,3,4-Tetrahydro-isoquinoline-7-carboxylic acid

• Catalog Number: ACMA00002955
• Product Name: 1,2,3,4-Tetrahydro-isoquinoline-7-carboxylic acid
• Category: Ethers
• Molecular Weight: 177.20
• Molecular Formula: C₉H₇F₃O₄
• Hazard Statements: H317-H319
• RIDADR: UN 3077 9 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 1,2,3,4-Tetrahydro-isoquinoline-7-carboxylic acid?

The molecular formula is C10H11NO2.

What is the molecular weight of 1,2,3,4-Tetrahydro-isoquinoline-7-carboxylic acid?

The molecular weight is 177.20 g/mol.

What is the IUPAC name of 1,2,3,4-Tetrahydro-isoquinoline-7-carboxylic acid?

The IUPAC name is 1,2,3,4-tetrahydroisoquinoline-7-carboxylic acid.

What is the InChI of 1,2,3,4-Tetrahydro-isoquinoline-7-carboxylic acid?

The InChI is InChI=1S/C10H11NO2/c12-10(13)8-2-1-7-3-4-11-6-9(7)5-8/h1-2,5,11H,3-4,6H2,(H,12,13).

What is the InChIKey of 1,2,3,4-Tetrahydro-isoquinoline-7-carboxylic acid?

The InChIKey is CQNSOIKACZHLHP-UHFFFAOYSA-N.

What is the canonical SMILES of 1,2,3,4-Tetrahydro-isoquinoline-7-carboxylic acid?

The canonical SMILES is C1CNCC2=C1C=CC(=C2)C(=O)O.

What is the ChEMBL ID of 1,2,3,4-Tetrahydro-isoquinoline-7-carboxylic acid?

The ChEMBL ID is CHEMBL341882.

What is the XLogP3-AA value of 1,2,3,4-Tetrahydro-isoquinoline-7-carboxylic acid?

The XLogP3-AA value is -1.4.

What is the hydrogen bond donor count of 1,2,3,4-Tetrahydro-isoquinoline-7-carboxylic acid?

The hydrogen bond donor count is 2.

What is the hydrogen bond acceptor count of 1,2,3,4-Tetrahydro-isoquinoline-7-carboxylic acid?

The hydrogen bond acceptor count is 3.