What is the molecular formula of 1,2,3,4-Tetrahydro-6-quinolinecarboxylic acid?
The molecular formula is C10H11NO2.
What is the PubChem CID number of 1,2,3,4-Tetrahydro-6-quinolinecarboxylic acid?
The PubChem CID number is 2779641.
What is the IUPAC name of 1,2,3,4-Tetrahydro-6-quinolinecarboxylic acid?
The IUPAC name is 1,2,3,4-tetrahydroquinoline-6-carboxylic acid.
What is the InChI of 1,2,3,4-Tetrahydro-6-quinolinecarboxylic acid?
The InChI is InChI=1S/C10H11NO2/c12-10(13)8-3-4-9-7(6-8)2-1-5-11-9/h3-4,6,11H,1-2,5H2,(H,12,13).
What is the InChIKey of 1,2,3,4-Tetrahydro-6-quinolinecarboxylic acid?
The InChIKey is ARNALYPZOYPNAF-UHFFFAOYSA-N.
What is the Canonical SMILES of 1,2,3,4-Tetrahydro-6-quinolinecarboxylic acid?
The Canonical SMILES is C1CC2=C(C=CC(=C2)C(=O)O)NC1.
What is the molecular weight of 1,2,3,4-Tetrahydro-6-quinolinecarboxylic acid?
The molecular weight is 177.20 g/mol.
What is the XLogP3 value of 1,2,3,4-Tetrahydro-6-quinolinecarboxylic acid?
The XLogP3 value is 1.8.
How many hydrogen bond donor counts does 1,2,3,4-Tetrahydro-6-quinolinecarboxylic acid have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 1,2,3,4-Tetrahydro-6-quinolinecarboxylic acid have?
It has 3 hydrogen bond acceptor counts.