What is the chemical formula of 1,2,2-Trifluorostyrene?
The chemical formula of 1,2,2-Trifluorostyrene is C8H5F3.
What is the molecular weight of 1,2,2-Trifluorostyrene?
The molecular weight of 1,2,2-Trifluorostyrene is 158.12 g/mol.
What is the IUPAC name of 1,2,2-Trifluorostyrene?
The IUPAC name of 1,2,2-Trifluorostyrene is 1,2,2-trifluoroethenylbenzene.
What is the InChI of 1,2,2-Trifluorostyrene?
The InChI of 1,2,2-Trifluorostyrene is InChI=1S/C8H5F3/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5H.
What is the InChIKey of 1,2,2-Trifluorostyrene?
The InChIKey of 1,2,2-Trifluorostyrene is SUTQSIHGGHVXFK-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2,2-Trifluorostyrene?
The canonical SMILES of 1,2,2-Trifluorostyrene is C1=CC=C(C=C1)C(=C(F)F)F.
What is the CAS number of 1,2,2-Trifluorostyrene?
The CAS number of 1,2,2-Trifluorostyrene is 447-14-3.
How many hydrogen bond donor counts does 1,2,2-Trifluorostyrene have?
1,2,2-Trifluorostyrene has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 1,2,2-Trifluorostyrene have?
1,2,2-Trifluorostyrene has 3 hydrogen bond acceptor counts.