1.12,2.3,4.5,6.7,8.9,10.11-Hexabenzocoronene

• CAS: 190-24-9
• Catalog Number: ACM190249
• Category: Other Products
• Molecular Weight: 522.59
• Molecular Formula: C₄₂H₁₈
• Synonyms: Hexabenzo[bc:ef:hi:kl:no:qr]coronene;1.12,2.3,4.5,6.7,8.9,10.11-HEXABENZOCORONENE;Nsc91579;[bc,ef,hi,kl,no,qr]-Hexabenzocoronene

Custom Q&A

What is the molecular formula of 1.12,2.3,4.5,6.7,8.9,10.11-Hexabenzocoronene?

The molecular formula is C42H18.

What is the molecular weight of 1.12,2.3,4.5,6.7,8.9,10.11-Hexabenzocoronene?

The molecular weight is 522.6 g/mol.

What is the IUPAC name of 1.12,2.3,4.5,6.7,8.9,10.11-Hexabenzocoronene?

The IUPAC name is tridecacyclo[28.12.0.0 2,15 .0 3,8 .0 4,41 .0 9,14 .0 13,18 .0 16,29 .0 17,22 .0 23,28 .0 27,32 .0 31,36 .0 37,42 ]dotetraconta-1(42),2,4(41),5,7,9(14),10,12,15,17,19,21,23,25,27,29,31(36),32,34,37,39-henicosaene.

What is the InChIKey of 1.12,2.3,4.5,6.7,8.9,10.11-Hexabenzocoronene?

The InChIKey is IVJZBYVRLJZOOQ-UHFFFAOYSA-N.

What is the Canonical SMILES of 1.12,2.3,4.5,6.7,8.9,10.11-Hexabenzocoronene?

The Canonical SMILES is C1=CC2=C3C=CC=C4C3=C5C6=C2C(=C1)C7=C8C6=C9C1=C(C8=CC=C7)C=CC=C1C1=CC=CC2=C1C9=C5C1=C4C=CC=C21.

What is the CAS number of 1.12,2.3,4.5,6.7,8.9,10.11-Hexabenzocoronene?

The CAS number is 190-24-9.

How many hydrogen bond donor counts are there in 1.12,2.3,4.5,6.7,8.9,10.11-Hexabenzocoronene?

There are 0 hydrogen bond donor counts.

What is the XLogP3-AA value of 1.12,2.3,4.5,6.7,8.9,10.11-Hexabenzocoronene?

The XLogP3-AA value is 12.

How many heavy atoms are there in 1.12,2.3,4.5,6.7,8.9,10.11-Hexabenzocoronene?

There are 42 heavy atoms.

What is the complexity value of 1.12,2.3,4.5,6.7,8.9,10.11-Hexabenzocoronene?

The complexity value is 864.