What is the molecular formula of 1,1-Diphenylhydrazine?
The molecular formula of 1,1-Diphenylhydrazine is C12H12N2.
What is the molecular weight of 1,1-Diphenylhydrazine?
The molecular weight of 1,1-Diphenylhydrazine is 184.24 g/mol.
What is the IUPAC name of 1,1-Diphenylhydrazine?
The IUPAC name of 1,1-Diphenylhydrazine is 1,1-diphenylhydrazine.
What is the InChI of 1,1-Diphenylhydrazine?
The InChI of 1,1-Diphenylhydrazine is InChI=1S/C12H12N2/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,13H2.
What is the InChIKey of 1,1-Diphenylhydrazine?
The InChIKey of 1,1-Diphenylhydrazine is YHYKLKNNBYLTQY-UHFFFAOYSA-N.
What is the Canonical SMILES of 1,1-Diphenylhydrazine?
The Canonical SMILES of 1,1-Diphenylhydrazine is C1=CC=C(C=C1)N(C2=CC=CC=C2)N.
What is the CAS number of 1,1-Diphenylhydrazine?
The CAS number of 1,1-Diphenylhydrazine is 530-50-7.
How many hydrogen bond donor counts does 1,1-Diphenylhydrazine have?
1,1-Diphenylhydrazine has one hydrogen bond donor count.
How many hydrogen bond acceptor counts does 1,1-Diphenylhydrazine have?
1,1-Diphenylhydrazine has two hydrogen bond acceptor counts.
How many rotatable bond counts does 1,1-Diphenylhydrazine have?
1,1-Diphenylhydrazine has two rotatable bond counts.