What is the molecular formula of 1,1-Diphenylethylene?
The molecular formula of 1,1-Diphenylethylene is C14H12.
What is the molecular weight of 1,1-Diphenylethylene?
The molecular weight of 1,1-Diphenylethylene is 180.24 g/mol.
What is the IUPAC name of 1,1-Diphenylethylene?
The IUPAC name of 1,1-Diphenylethylene is 1-phenylethenylbenzene.
What is the InChI of 1,1-Diphenylethylene?
The InChI of 1,1-Diphenylethylene is InChI=1S/C14H12/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11H,1H2.
What is the InChIKey of 1,1-Diphenylethylene?
The InChIKey of 1,1-Diphenylethylene is ZMYIIHDQURVDRB-UHFFFAOYSA-N.
What is the canonical SMILES of 1,1-Diphenylethylene?
The canonical SMILES of 1,1-Diphenylethylene is C=C(C1=CC=CC=C1)C2=CC=CC=C2.
What is the CAS number of 1,1-Diphenylethylene?
The CAS number of 1,1-Diphenylethylene is 530-48-3.
What is the UNII of 1,1-Diphenylethylene?
The UNII of 1,1-Diphenylethylene is BX0L5B6LLL.
What is the Nikkaji Number of 1,1-Diphenylethylene?
The Nikkaji Number of 1,1-Diphenylethylene is J6.702D.
What is the XLogP3-AA value of 1,1-Diphenylethylene?
The XLogP3-AA value of 1,1-Diphenylethylene is 4.6.