What is the molecular formula of 1,1,1,3,3,5,5-Heptamethyltrisiloxane?
The molecular formula of 1,1,1,3,3,5,5-Heptamethyltrisiloxane is C7H21O2Si3.
What is the molecular weight of 1,1,1,3,3,5,5-Heptamethyltrisiloxane?
The molecular weight of 1,1,1,3,3,5,5-Heptamethyltrisiloxane is 221.50 g/mol.
What is the InChI of 1,1,1,3,3,5,5-Heptamethyltrisiloxane?
The InChI of 1,1,1,3,3,5,5-Heptamethyltrisiloxane is InChI=1S/C7H21O2Si3/c1-10(2)8-12(6,7)9-11(3,4)5/h1-7H3.
What is the InChIKey of 1,1,1,3,3,5,5-Heptamethyltrisiloxane?
The InChIKey of 1,1,1,3,3,5,5-Heptamethyltrisiloxane is GDDVTIGTERZVBW-UHFFFAOYSA-N.
What is the canonical SMILES of 1,1,1,3,3,5,5-Heptamethyltrisiloxane?
The canonical SMILES of 1,1,1,3,3,5,5-Heptamethyltrisiloxane is C[Si](C)O[Si](C)(C)O[Si](C)(C)C.
What is the CAS number of 1,1,1,3,3,5,5-Heptamethyltrisiloxane?
The CAS number of 1,1,1,3,3,5,5-Heptamethyltrisiloxane is 2895-07-0.
What is the EC number of 1,1,1,3,3,5,5-Heptamethyltrisiloxane?
The EC number of 1,1,1,3,3,5,5-Heptamethyltrisiloxane is 220-774-5.
What is the hydrogen bond donor count of 1,1,1,3,3,5,5-Heptamethyltrisiloxane?
The hydrogen bond donor count of 1,1,1,3,3,5,5-Heptamethyltrisiloxane is 0.
What is the hydrogen bond acceptor count of 1,1,1,3,3,5,5-Heptamethyltrisiloxane?
The hydrogen bond acceptor count of 1,1,1,3,3,5,5-Heptamethyltrisiloxane is 2.
What is the rotatable bond count of 1,1,1,3,3,5,5-Heptamethyltrisiloxane?
The rotatable bond count of 1,1,1,3,3,5,5-Heptamethyltrisiloxane is 4.