What is the PubChem CID of vinyl decanoate?
The PubChem CID of vinyl decanoate is 62140.
What is the molecular formula of vinyl decanoate?
The molecular formula of vinyl decanoate is C12H22O2.
What is the molecular weight of vinyl decanoate?
The molecular weight of vinyl decanoate is 198.30 g/mol.
When was vinyl decanoate created?
Vinyl decanoate was created on March 26, 2005.
When was vinyl decanoate last modified?
Vinyl decanoate was last modified on December 2, 2023.
What is the IUPAC name of vinyl decanoate?
The IUPAC name of vinyl decanoate is ethenyl decanoate.
What is the InChI of vinyl decanoate?
The InChI of vinyl decanoate is InChI=1S/C12H22O2/c1-3-5-6-7-8-9-10-11-12(13)14-4-2/h4H,2-3,5-11H2,1H3.
What is the InChIKey of vinyl decanoate?
The InChIKey of vinyl decanoate is CMDXMIHZUJPRHG-UHFFFAOYSA-N.
What is the canonical SMILES of vinyl decanoate?
The canonical SMILES of vinyl decanoate is CCCCCCCCCC(=O)OC=C.
What is the CAS number of vinyl decanoate?
The CAS number of vinyl decanoate is 4704-31-8.