What is the molecular formula of Vat Yellow 4?
The molecular formula of Vat Yellow 4 is C24H12O2.
What is the molecular weight of Vat Yellow 4?
The molecular weight of Vat Yellow 4 is 332.3 g/mol.
What is Vat Yellow 4 used for?
Vat Yellow 4 is used for coloring cotton, wool, and cellulose acetate.
What are some synonyms for Vat Yellow 4?
Some synonyms for Vat Yellow 4 include C.I. Vat Yellow 4, Vat yellow 4, Dibenzo[B,def]chrysene-7,14-dione, and Tyrion Yellow.
What is the Canonical SMILES representation of Vat Yellow 4?
The Canonical SMILES representation of Vat Yellow 4 is C1=CC=C2C(=C1)C3=C4C(=CC=C5C4=C(C=C3)C(=O)C6=CC=CC=C65)C2=O.
What is the InChIKey of Vat Yellow 4?
The InChIKey of Vat Yellow 4 is ZTWQZJLUUZHJGS-UHFFFAOYSA-N.
What is the XLogP3-AA value of Vat Yellow 4?
The XLogP3-AA value of Vat Yellow 4 is 5.4.
How many Hydrogen Bond Acceptor Counts does Vat Yellow 4 have?
Vat Yellow 4 has 2 Hydrogen Bond Acceptor Counts.
What is the Topological Polar Surface Area of Vat Yellow 4?
The Topological Polar Surface Area of Vat Yellow 4 is 34.1 Å^2.
How many Heavy Atoms are present in the structure of Vat Yellow 4?
There are 26 Heavy Atoms in the structure of Vat Yellow 4.