What is the molecular formula of Vat Red 41?
The molecular formula of Vat Red 41 is C16H8O2S2.
What is the molecular weight of Vat Red 41?
The molecular weight of Vat Red 41 is 296.4 g/mol.
What is the IUPAC name of Vat Red 41?
The IUPAC name of Vat Red 41 is (2E)-2-(3-oxo-1-benzothiophen-2-ylidene)-1-benzothiophen-3-one.
What is the InChI of Vat Red 41?
The InChI of Vat Red 41 is InChI=1S/C16H8O2S2/c17-13-9-5-1-3-7-11(9)19-15(13)16-14(18)10-6-2-4-8-12(10)20-16/h1-8H/b16-15+.
What is the InChIKey of Vat Red 41?
The InChIKey of Vat Red 41 is JOUDBUYBGJYFFP-FOCLMDBBSA-N.
What is the canonical SMILES of Vat Red 41?
The canonical SMILES of Vat Red 41 is C1=CC=C2C(=C1)C(=O)C(=C3C(=O)C4=CC=CC=C4S3)S2.
How many hydrogen bond donor counts does Vat Red 41 have?
Vat Red 41 has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Vat Red 41 have?
Vat Red 41 has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of Vat Red 41?
The topological polar surface area of Vat Red 41 is 84.7 ?2.
Is Vat Red 41 a canonicalized compound?
Yes, Vat Red 41 is a canonicalized compound.