What is the molecular formula of Vat Red 10?
The molecular formula of Vat Red 10 is C29H14N2O5.
What is the molecular weight of Vat Red 10?
The molecular weight of Vat Red 10 is 470.4 g/mol.
What is the IUPAC name of Vat Red 10?
The IUPAC name of Vat Red 10 is 2-(1-amino-9,10-dioxoanthracen-2-yl)naphtho[2,3-f][1,3]benzoxazole-5,10-dione.
What is the InChI of Vat Red 10?
The InChI of Vat Red 10 is InChI=1S/C29H14N2O5/c30-24-18(10-9-17-23(24)28(35)16-8-4-3-7-15(16)25(17)32)29-31-21-11-19-20(12-22(21)36-29)27(34)14-6-2-1-5-13(14)26(19)33/h1-12H,30H2.
What is the InChIKey of Vat Red 10?
The InChIKey of Vat Red 10 is RHEVAQGXLUQWBM-UHFFFAOYSA-N.
What is the canonical SMILES of Vat Red 10?
The canonical SMILES of Vat Red 10 is C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C=C3)C4=NC5=C(O4)C=C6C(=C5)C(=O)C7=CC=CC=C7C6=O)N.
What is the CAS number of Vat Red 10?
The CAS number of Vat Red 10 is 2379-79-5.
How many hydrogen bond donors are there in Vat Red 10?
There is 1 hydrogen bond donor in Vat Red 10.
How many hydrogen bond acceptors are there in Vat Red 10?
There are 7 hydrogen bond acceptors in Vat Red 10.