2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine vanadium(IV) oxide can prepare π cation radical derivative [VO (OH)2(OEP)]SBCl6, which can be used as sensor active material.
What is molecular formula of 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine vanadium(IV) oxide?
C36H44N4OV
What is formula weight of 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine vanadium(IV) oxide?
599.7
What is Isomeric SMILES of 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine vanadium(IV) oxide?
It is CCC1=C(C2=CC3=NC(=CC4=C(C(=C([N-]4)C=C5C(=C(C(=N5)C=C1[N-]2)CC)CC)CC)CC)C(=C3CC)CC)CC.O=[V+2].
What is the topological polar surface area of 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine vanadium(IV) oxide?
43.8 Ų
What is the heavy atom count of 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine vanadium(IV) oxide?
42
※ Please kindly note that our products are for research use only.