What is the molecular formula of Unifiram?
The molecular formula of Unifiram is C13H15FN2O3S.
What is the molecular weight of Unifiram?
The molecular weight of Unifiram is 298.34 g/mol.
What is the synonym for Unifiram?
The synonym for Unifiram is DM-232.
When was Unifiram created?
Unifiram was created on October 25, 2006.
What is the IUPAC name of Unifiram?
The IUPAC name of Unifiram is 2-(4-fluorophenyl)sulfonyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
What is the InChI of Unifiram?
The InChI of Unifiram is InChI=1S/C13H15FN2O3S/c14-10-1-4-12(5-2-10)20(18,19)15-7-8-16-11(9-15)3-6-13(16)17/h1-2,4-5,11H,3,6-9H2.
What is the InChIKey of Unifiram?
The InChIKey of Unifiram is SNRTZFZAFBIBJP-UHFFFAOYSA-N.
What is the canonical SMILES of Unifiram?
The canonical SMILES of Unifiram is C1CC(=O)N2C1CN(CC2)S(=O)(=O)C3=CC=C(C=C3)F.
What is the CAS number of Unifiram?
The CAS number of Unifiram is 272786-64-8.
What is the UNII of Unifiram?
The UNII of Unifiram is N4024LN29G.