What is the PubChem CID for Tritoqualine?
The PubChem CID for Tritoqualine is 72145.
What is the molecular formula of Tritoqualine?
The molecular formula of Tritoqualine is C26H32N2O8.
What is the molecular weight of Tritoqualine?
The molecular weight of Tritoqualine is 500.5 g/mol.
When was Tritoqualine created?
Tritoqualine was created on August 8, 2005.
What is the IUPAC name of Tritoqualine?
The IUPAC name of Tritoqualine is 7-amino-4,5,6-triethoxy-3-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-3H-2-benzofuran-1-one.
What is the InChIKey of Tritoqualine?
The InChIKey of Tritoqualine is IRGJVQIJENCTQF-UHFFFAOYSA-N.
What is the canonical SMILES of Tritoqualine?
The canonical SMILES of Tritoqualine is CCOC1=C(C(=C(C2=C1C(OC2=O)C3C4=C(C5=C(C=C4CCN3C)OCO5)OC)N)OCC)OCC.
What is the CAS number of Tritoqualine?
The CAS number of Tritoqualine is 14504-73-5.
What is the XLogP3-AA value of Tritoqualine?
The XLogP3-AA value of Tritoqualine is 3.7.
What is the hydrogen bond acceptor count of Tritoqualine?
The hydrogen bond acceptor count of Tritoqualine is 10.