What is the molecular formula of Tris(undecafluoropentyl)amine?
The molecular formula is N(C5F11)3.
What is the molecular weight of Tris(undecafluoropentyl)amine?
The molecular weight is 821.11 g/mol.
What are the synonyms of Tris(undecafluoropentyl)amine?
The synonyms are perfluorotripentylamine, 338-84-1, Tris(undecafluoropentyl)amine, Tris(perfluoropentyl)amine, and Fluorocarbon FC 70.
What is the IUPAC name of Tris(undecafluoropentyl)amine?
The IUPAC name is 1,1,2,2,3,3,4,4,5,5,5-undecafluoro-N,N-bis(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)pentan-1-amine.
What is the InChI of Tris(undecafluoropentyl)amine?
The InChI is InChI=1S/C15F33N/c16-1(17,4(22,23)10(34,35)36)7(28,29)13(43,44)49(14(45,46)8(30,31)2(18,19)5(24,25)11(37,38)39)15(47,48)9(32,33)3(20,21)6(26,27)12(40,41)42.
What is the InChIKey of Tris(undecafluoropentyl)amine?
The InChIKey is AQZYBQIAUSKCCS-UHFFFAOYSA-N.
What is the canonical SMILES of Tris(undecafluoropentyl)amine?
The canonical SMILES is C(C(C(N(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F.
What is the CAS number of Tris(undecafluoropentyl)amine?
The CAS number is 338-84-1.
What is the XLogP3-AA value of Tris(undecafluoropentyl)amine?
The XLogP3-AA value is 11.9.
What is the hydrogen bond donor count of Tris(undecafluoropentyl)amine?
The hydrogen bond donor count is 0.