What is the molecular formula of Tripropyl orthoformate?
The molecular formula of Tripropyl orthoformate is C10H22O3.
What is the molecular weight of Tripropyl orthoformate?
The molecular weight of Tripropyl orthoformate is 190.28 g/mol.
What is the IUPAC name of Tripropyl orthoformate?
The IUPAC name of Tripropyl orthoformate is 1-(dipropoxymethoxy)propane.
What is the InChI of Tripropyl orthoformate?
The InChI of Tripropyl orthoformate is InChI=1S/C10H22O3/c1-4-7-11-10(12-8-5-2)13-9-6-3/h10H,4-9H2,1-3H3.
What is the InChIKey of Tripropyl orthoformate?
The InChIKey of Tripropyl orthoformate is RWNXXQFJBALKAX-UHFFFAOYSA-N.
What is the CAS number of Tripropyl orthoformate?
The CAS number of Tripropyl orthoformate is 621-76-1.
What is the XLogP3-AA value of Tripropyl orthoformate?
The XLogP3-AA value of Tripropyl orthoformate is 2.7.
What is the hydrogen bond donor count of Tripropyl orthoformate?
The hydrogen bond donor count of Tripropyl orthoformate is 0.
What is the hydrogen bond acceptor count of Tripropyl orthoformate?
The hydrogen bond acceptor count of Tripropyl orthoformate is 3.
Is Tripropyl orthoformate a canonicalized compound?
Yes, Tripropyl orthoformate is a canonicalized compound.