What is the PubChem CID of Triphenyltin fluoride?
The PubChem CID of Triphenyltin fluoride is 9786.
What is the molecular formula of Triphenyltin fluoride?
The molecular formula of Triphenyltin fluoride is C18H15FSn.
What are the synonyms of Triphenyltin fluoride?
The synonyms of Triphenyltin fluoride are TRIPHENYLTIN FLUORIDE, 379-52-2, Fentin fluoride, Fluorotriphenylstannane, and Stannane.
What is the molecular weight of Triphenyltin fluoride?
The molecular weight of Triphenyltin fluoride is 369.0 g/mol.
When was Triphenyltin fluoride created and modified?
Triphenyltin fluoride was created on July 19, 2005, and last modified on December 30, 2023.
What is the IUPAC name of Triphenyltin fluoride?
The IUPAC name of Triphenyltin fluoride is fluoro(triphenyl)stannane.
What is the InChI of Triphenyltin fluoride?
The InChI of Triphenyltin fluoride is InChI=1S/3C6H5.FH.Sn/c3*1-2-4-6-5-3-1;;/h3*1-5H;1H;/q;;;;+1/p-1.
What is the InChIKey of Triphenyltin fluoride?
The InChIKey of Triphenyltin fluoride is JBYRKMGOSFMHRL-UHFFFAOYSA-M.
What is the canonical SMILES of Triphenyltin fluoride?
The canonical SMILES of Triphenyltin fluoride is C1=CC=C(C=C1)[Sn](C2=CC=CC=C2)(C3=CC=CC=C3)F.
Is Triphenyltin fluoride a covalently-bonded unit?
Yes, Triphenyltin fluoride is a covalently-bonded unit.