Trioctyltin chloride

• Catalog Number: ACM2587760
• Product Name: Trioctyltin chloride
• CAS: 2587-76-0
• Category: Organic Tin
• Synonyms: chlorotrioctyl-stannan;chlorotrioctyl-ti;chlorotrioctyltin;trioctyltinchloride(6ci);chlorotrioctylstannane;TRI-N-OCTYLTIN CHLORIDE;TRI-N-OCTYLCHLOROTIN;TRIOCTYLTIN CHLORIDE
• Molecular Weight: 493.82
• Molecular Formula: C₂₄H₅₁ClSn

Custom Q&A

What is the molecular formula of Trioctyltin chloride?

The molecular formula of Trioctyltin chloride is C24H51ClSn.

What is the molecular weight of Trioctyltin chloride?

The molecular weight of Trioctyltin chloride is 493.8 g/mol.

What is the IUPAC name of Trioctyltin chloride?

The IUPAC name of Trioctyltin chloride is chloro(trioctyl)stannane.

What is the InChI key of Trioctyltin chloride?

The InChI key of Trioctyltin chloride is MCNGJXAXOJDJKO-UHFFFAOYSA-M.

What is the canonical SMILES of Trioctyltin chloride?

The canonical SMILES of Trioctyltin chloride is CCCCCCCC[Sn](CCCCCCCC)(CCCCCCCC)Cl.

What is the CAS number of Trioctyltin chloride?

The CAS number of Trioctyltin chloride is 2587-76-0.

What is the EC number of Trioctyltin chloride?

The EC number of Trioctyltin chloride is 219-969-8.

What is the UNII of Trioctyltin chloride?

The UNII of Trioctyltin chloride is 176VII0B0K.

What is the DSSTox Substance ID of Trioctyltin chloride?

The DSSTox Substance ID of Trioctyltin chloride is DTXSID3029657.

What is the hydrobgen bond donor count of Trioctyltin chloride?

The hydrogen bond donor count of Trioctyltin chloride is 0.