What is the molecular formula of trihexyl phosphate?
The molecular formula of trihexyl phosphate is C18H39O4P.
What is the molecular weight of trihexyl phosphate?
The molecular weight of trihexyl phosphate is 350.5 g/mol.
How was the molecular weight of trihexyl phosphate calculated?
The molecular weight of trihexyl phosphate was computed by PubChem 2.2.
What is the IUPAC name of trihexyl phosphate?
The IUPAC name of trihexyl phosphate is trihexyl phosphate.
What is the InChI of trihexyl phosphate?
The InChI of trihexyl phosphate is InChI=1S/C18H39O4P/c1-4-7-10-13-16-20-23(19,21-17-14-11-8-5-2)22-18-15-12-9-6-3/h4-18H2,1-3H3.
What is the InChIKey of trihexyl phosphate?
The InChIKey of trihexyl phosphate is SFENPMLASUEABX-UHFFFAOYSA-N.
What is the canonical SMILES of trihexyl phosphate?
The canonical SMILES of trihexyl phosphate is CCCCCCOP(=O)(OCCCCCC)OCCCCCC.
What is the CAS number of trihexyl phosphate?
The CAS number of trihexyl phosphate is 2528-39-4.
What is the European Community (EC) number of trihexyl phosphate?
The European Community (EC) number of trihexyl phosphate is 219-774-8.
Is trihexyl phosphate considered a canonicalized compound?
Yes, trihexyl phosphate is considered a canonicalized compound according to PubChem.