What is the molecular formula of triformylmethane?
The molecular formula of triformylmethane is C4H4O3.
What is the molecular weight of triformylmethane?
The molecular weight of triformylmethane is 100.07 g/mol.
When was triformylmethane created and modified?
Triformylmethane was created on March 27, 2005, and modified on December 30, 2023.
What is the IUPAC name of triformylmethane?
The IUPAC name of triformylmethane is methanetricarbaldehyde.
What is the InChI of triformylmethane?
The InChI of triformylmethane is InChI=1S/C4H4O3/c5-1-4(2-6)3-7/h1-4H.
What is the InChIKey of triformylmethane?
The InChIKey of triformylmethane is WRWNFZAKUHZONV-UHFFFAOYSA-N.
What is the canonical SMILES of triformylmethane?
The canonical SMILES of triformylmethane is C(=O)C(C=O)C=O.
What is the CAS number of triformylmethane?
The CAS number of triformylmethane is 18655-47-5.
What is the XLogP3-AA value of triformylmethane?
The XLogP3-AA value of triformylmethane is -0.9.
How many hydrogen bond acceptors does triformylmethane have?
Triformylmethane has 3 hydrogen bond acceptors.