What is the molecular formula of Triethyl orthoformate-d1?
The molecular formula of Triethyl orthoformate-d1 is C7H16O3.
What is the molecular weight of Triethyl orthoformate-d1?
The molecular weight of Triethyl orthoformate-d1 is 148.20 g/mol.
What is the structure of Triethyl orthoformate-d1?
Triethyl orthoformate-d1 appears as a clear, colorless liquid with a pungent odor.
What are some synonyms for Triethyl orthoformate-d1?
Some synonyms for Triethyl orthoformate-d1 include Triethyl orthoformate, Triethoxymethane, and ETHYL ORTHOFORMATE.
What is the InChI of Triethyl orthoformate-d1?
The InChI of Triethyl orthoformate-d1 is InChI=1S/C7H16O3/c1-4-8-7(9-5-2)10-6-3/h7H,4-6H2,1-3H3.
What is the Canonical SMILES of Triethyl orthoformate-d1?
The Canonical SMILES of Triethyl orthoformate-d1 is CCOC(OCC)OCC.
How many hydrogen bond acceptor counts does Triethyl orthoformate-d1 have?
Triethyl orthoformate-d1 has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of Triethyl orthoformate-d1?
The topological polar surface area of Triethyl orthoformate-d1 is 27.7 Å2.
How many rotatable bond counts does Triethyl orthoformate-d1 have?
Triethyl orthoformate-d1 has 6 rotatable bond counts.
Is Triethyl orthoformate-d1 more or less dense than water?
Triethyl orthoformate-d1 is less dense than water.