What is the molecular formula of Tri-t-butoxysilanol?
The molecular formula of Tri-t-butoxysilanol is C12H28O4Si.
What is the molecular weight of Tri-t-butoxysilanol?
The molecular weight of Tri-t-butoxysilanol is 264.43 g/mol.
What is the IUPAC Name of Tri-t-butoxysilanol?
The IUPAC Name of Tri-t-butoxysilanol is hydroxy-tris[(2-methylpropan-2-yl)oxy]silane.
What is the InChI of Tri-t-butoxysilanol?
The InChI of Tri-t-butoxysilanol is InChI=1S/C12H28O4Si/c1-10(2,3)14-17(13,15-11(4,5)6)16-12(7,8)9/h13H,1-9H3.
What is the InChIKey of Tri-t-butoxysilanol?
The InChIKey of Tri-t-butoxysilanol is HLDBBQREZCVBMA-UHFFFAOYSA-N.
What is the Canonical SMILES of Tri-t-butoxysilanol?
The Canonical SMILES of Tri-t-butoxysilanol is CC(C)(C)O[Si](O)(OC(C)(C)C)OC(C)(C)C.
What is the CAS number of Tri-t-butoxysilanol?
The CAS number of Tri-t-butoxysilanol is 18166-43-3.
How many hydrogen bond donor counts does Tri-t-butoxysilanol have?
Tri-t-butoxysilanol has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Tri-t-butoxysilanol have?
Tri-t-butoxysilanol has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does Tri-t-butoxysilanol have?
Tri-t-butoxysilanol has 6 rotatable bond counts.