What is the molecular formula of Tremulacin?
The molecular formula of Tremulacin is C27H28O11.
What is the molecular weight of Tremulacin?
The molecular weight of Tremulacin is 528.5 g/mol.
Where is Tremulacin found naturally?
Tremulacin is a natural product found in Populus tremula, Populus tomentosa, and other organisms.
What is the IUPAC name of Tremulacin?
The IUPAC name of Tremulacin is [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[(1-hydroxy-6-oxocyclohex-2-ene-1-carbonyl)oxymethyl]phenoxy]oxan-3-yl] benzoate.
What are the synonyms of Tremulacin?
The synonyms of Tremulacin include 29836-40-6, MLS001424184, and CHEBI:9657.
What is the InChIKey of Tremulacin?
The InChIKey of Tremulacin is RCKCYCDBDYUIGM-LFMHJWGUSA-N.
What is the Canonical SMILES of Tremulacin?
The Canonical SMILES of Tremulacin is C1CC(=O)C(C=C1)(C(=O)OCC2=CC=CC=C2OC3C(C(C(C(O3)CO)O)O)OC(=O)C4=CC=CC=C4)O.
What is the CAS number of Tremulacin?
The CAS number of Tremulacin is 29836-40-6.
How many hydrogen bond donor counts does Tremulacin have?
Tremulacin has 4 hydrogen bond donor counts.
What is the topological polar surface area of Tremulacin?
The topological polar surface area of Tremulacin is 169 Ų.