What is the molecular formula of trans-Ocimene?
The molecular formula of trans-Ocimene is C10H16.
What is the molecular weight of trans-Ocimene?
The molecular weight of trans-Ocimene is 136.23 g/mol.
What is the IUPAC name of trans-Ocimene?
The IUPAC name of trans-Ocimene is (3E)-3,7-dimethylocta-1,3,6-triene.
What is the InChI of trans-Ocimene?
The InChI of trans-Ocimene is InChI=1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7-8H,1,6H2,2-4H3/b10-8+.
What is the InChIKey of trans-Ocimene?
The InChIKey of trans-Ocimene is IHPKGUQCSIINRJ-CSKARUKUSA-N.
What are the synonyms of trans-Ocimene?
The synonyms of trans-Ocimene are OCIMENE, (E)-beta-ocimene, and trans-beta-Ocimene.
Where can trans-Ocimene be found naturally?
trans-Ocimene can be found in Nepeta nepetella and Xylopia aromatica, among other organisms.
What is the CAS number of trans-Ocimene?
The CAS number of trans-Ocimene is 3779-61-1.
What is the Canonical SMILES of trans-Ocimene?
The Canonical SMILES of trans-Ocimene is CC(=CCC=C(C)C=C)C.