What is the molecular formula of trans-2-Methyl-3-phenyl-2-propen-1-ol?
The molecular formula is C10H12O.
What is the molecular weight of trans-2-Methyl-3-phenyl-2-propen-1-ol?
The molecular weight is 148.20 g/mol.
What is the IUPAC name of trans-2-Methyl-3-phenyl-2-propen-1-ol?
The IUPAC name is (E)-2-methyl-3-phenylprop-2-en-1-ol.
What is the InChI of trans-2-Methyl-3-phenyl-2-propen-1-ol?
The InChI is InChI=1S/C10H12O/c1-9(8-11)7-10-5-3-2-4-6-10/h2-7,11H,8H2,1H3/b9-7+.
What is the InChIKey of trans-2-Methyl-3-phenyl-2-propen-1-ol?
The InChIKey is LLNAMUJRIZIXHF-VQHVLOKHSA-N.
What are the synonyms of trans-2-Methyl-3-phenyl-2-propen-1-ol?
The synonyms are 1504-55-8, 2-Methyl-3-phenyl-2-propen-1-ol, beta-Methylcinnamyl alcohol, 2-methyl-3-phenylprop-2-en-1-ol, and alpha-Methylcinnamyl alcohol.
What is the XLogP3-AA value of trans-2-Methyl-3-phenyl-2-propen-1-ol?
The XLogP3-AA value is 2.3.
How many hydrogen bond donor counts does trans-2-Methyl-3-phenyl-2-propen-1-ol have?
It has 1 hydrogen bond donor count.
How many rotatable bond counts does trans-2-Methyl-3-phenyl-2-propen-1-ol have?
It has 2 rotatable bond counts.
What is the topological polar surface area of trans-2-Methyl-3-phenyl-2-propen-1-ol?
The topological polar surface area is 20.2 Ų.
※ Please kindly note that our products are for research use only.