What is the molecular formula of tranexamic acid?
The molecular formula of tranexamic acid is C8H15NO2.
What is the molecular weight of tranexamic acid?
The molecular weight of tranexamic acid is 157.21 g/mol.
What is the IUPAC name of tranexamic acid?
The IUPAC name of tranexamic acid is 4-(aminomethyl)cyclohexane-1-carboxylic acid.
What is the InChI code of tranexamic acid?
The InChI code of tranexamic acid is InChI=1S/C8H15NO2/c9-5-6-1-3-7(4-2-6)8(10)11/h6-7H,1-5,9H2,(H,10,11).
What is the InChIKey of tranexamic acid?
The InChIKey of tranexamic acid is GYDJEQRTZSCIOI-UHFFFAOYSA-N.
What are the synonyms of tranexamic acid?
The synonyms of tranexamic acid include tranexamic acid, trans-4-(aminomethyl)cyclohexanecarboxylic acid, Cyklokapron, and 4-(aminomethyl)cyclohexanecarboxylic acid.
What is the function of tranexamic acid?
Tranexamic acid has a role as an antifibrinolytic drug and a hematologic agent.
What is the drug classification of tranexamic acid?
Tranexamic acid is classified as an Antifibrinolytic Agent.
When was tranexamic acid first patented?
Tranexamic acid was first patented in 1957.
What is the primary therapeutic use of tranexamic acid?
Tranexamic acid is used as an antifibrinolytic in the treatment and prevention of major bleeding.