What is the molecular formula of tetraphenyllead?
The molecular formula of tetraphenyllead is C24H20Pb.
What is the molecular weight of tetraphenyllead?
The molecular weight of tetraphenyllead is 515 g/mol.
What is the IUPAC name of tetraphenyllead?
The IUPAC name of tetraphenyllead is tetraphenylplumbane.
What is the InChI of tetraphenyllead?
The InChI of tetraphenyllead is InChI=1S/4C6H5.Pb/c4*1-2-4-6-5-3-1;/h4*1-5H.
What is the InChIKey of tetraphenyllead?
The InChIKey of tetraphenyllead is WBJSMHDYLOJVKC-UHFFFAOYSA-N.
What is the canonical SMILES of tetraphenyllead?
The canonical SMILES of tetraphenyllead is C1=CC=C(C=C1)[Pb](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.
What is the CAS number of tetraphenyllead?
The CAS number of tetraphenyllead is 595-89-1.
What is the European Community (EC) number of tetraphenyllead?
The European Community (EC) number of tetraphenyllead is 209-871-3.
What is the UNII of tetraphenyllead?
The UNII of tetraphenyllead is 2K9SW63R4N.
Is tetraphenyllead the canonicalized compound?
Yes, tetraphenyllead is the canonicalized compound according to PubChem.