What is the molecular formula of Tetrabutylammonium borohydride?
The molecular formula of Tetrabutylammonium borohydride is C16H36BN.
What are the synonyms for Tetrabutylammonium borohydride?
The synonyms for Tetrabutylammonium borohydride include Tetra-N-butylammonium borohydride, Tetrabutylammonium tetrahydroborate, and 1-Butanaminium, N, N, N-tributyl-, tetrahydroborate(1-).
What is the molecular weight of Tetrabutylammonium borohydride?
The molecular weight of Tetrabutylammonium borohydride is 253.3 g/mol.
What are the component compounds of Tetrabutylammonium borohydride?
The component compounds of Tetrabutylammonium borohydride are Boride(1-) (CID 6328187) and Tetrabutylammonium (CID 16028).
What is the InChI of Tetrabutylammonium borohydride?
The InChI of Tetrabutylammonium borohydride is InChI=1S/C16H36N.B/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;/q+1;-1.
What is the InChIKey of Tetrabutylammonium borohydride?
The InChIKey of Tetrabutylammonium borohydride is SGIQRFZMJGZMNT-UHFFFAOYSA-N.
What is the canonical SMILES of Tetrabutylammonium borohydride?
The canonical SMILES of Tetrabutylammonium borohydride is [B-].CCCC[N+](CCCC)(CCCC)CCCC.
What is the CAS number of Tetrabutylammonium borohydride?
The CAS number of Tetrabutylammonium borohydride is 33725-74-5.
What is the European Community (EC) number of Tetrabutylammonium borohydride?
The European Community (EC) number of Tetrabutylammonium borohydride is 251-658-2.
Is Tetrabutylammonium borohydride a canonicalized compound?
Yes, Tetrabutylammonium borohydride is a canonicalized compound.
※ Please kindly note that our products are for research use only.