What is the PubChem CID of Teferrol?
PubChem CID 76960246
What is the molecular formula of Teferrol?
The molecular formula of Teferrol is C12H25FeO14.
What is the molecular weight of Teferrol?
The molecular weight of Teferrol is 449.16 g/mol.
When was Teferrol created?
Teferrol was created on August 25, 2014.
When was Teferrol last modified?
Teferrol was last modified on December 30, 2023.
What is the IUPAC name of Teferrol?
The IUPAC name of Teferrol is iron(3+);(2R,3S,4R,5R)-2,3,4,5-tetrahydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanal;trihydroxide.
What is the InChI of Teferrol?
The InChI of Teferrol is InChI=1S/C12H22O11.Fe.3H2O/c13-1-4(15)7(17)8(18)5(16)3-22-12-11(21)10(20)9(19)6(2-14)23-12;;;;/h1,4-12,14-21H,2-3H2;;3*1H2/q;+3;;;/p-3/t4-,5+,6+,7+,8+,9+,10-,11+,12-;;;;/m0..../s1.
What is the molecular formula of Teferrol according to PubChem?
The molecular formula of Teferrol according to PubChem is C12H25FeO14.
What CAS number is associated with Teferrol?
The CAS number associated with Teferrol is 53858-86-9.
What is the hydrogen bond donor count of Teferrol?
The hydrogen bond donor count of Teferrol is 11.